C22H25NO2 — CID 66958912
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2,3-diphenylpropanoate (PubChem CID 66958912) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2,3-diphenylpropanoate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2,3-diphenylpropanoate |
|---|---|
| PubChem CID | 66958912 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2,3-diphenylpropanoate |
| SMILES | O=C(O[C@H]1CN2CCC1CC2)C(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c24-22(25-21-16-23-13-11-19(21)12-14-23)20(18-9-5-2-6-10-18)15-17-7-3-1-4-8-17/h1-10,19-21H,11-16H2/t20?,21-/m0/s1 |
| InChIKey | HIGMOHMJHSQSEI-LBAQZLPGSA-N |
| XLogP | 3.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |