C24H29NO3 — CID 91369986
1-azabicyclo[2.2.2]octan-3-yl 4-(4-methoxyphenyl)-2-phenylbutanoate (PubChem CID 91369986) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl 4-(4-methoxyphenyl)-2-phenylbutanoate.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl 4-(4-methoxyphenyl)-2-phenylbutanoate |
|---|---|
| PubChem CID | 91369986 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl 4-(4-methoxyphenyl)-2-phenylbutanoate |
| SMILES | COc1ccc(CCC(C(=O)OC2CN3CCC2CC3)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H29NO3/c1-27-21-10-7-18(8-11-21)9-12-22(19-5-3-2-4-6-19)24(26)28-23-17-25-15-13-20(23)14-16-25/h2-8,10-11,20,22-23H,9,12-17H2,1H3 |
| InChIKey | HPJOVTKZVBRQOM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |