C23H26FN2O2+ — CID 91535286
[2-(1-azabicyclo[2.2.2]octan-3-yloxy)-2-oxo-1-phenylethyl]-[(4-fluorophenyl)methyl]-methylideneazanium (PubChem CID 91535286) has the molecular formula C23H26FN2O2+ and a molecular weight of 381.47 g/mol. Its IUPAC name is [2-(1-azabicyclo[2.2.2]octan-3-yloxy)-2-oxo-1-phenylethyl]-[(4-fluorophenyl)methyl]-methylideneazanium.
| Compound Name | [2-(1-azabicyclo[2.2.2]octan-3-yloxy)-2-oxo-1-phenylethyl]-[(4-fluorophenyl)methyl]-methylideneazanium |
|---|---|
| PubChem CID | 91535286 |
| Molecular Formula | C23H26FN2O2+ |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | [2-(1-azabicyclo[2.2.2]octan-3-yloxy)-2-oxo-1-phenylethyl]-[(4-fluorophenyl)methyl]-methylideneazanium |
| SMILES | C=[N+](Cc1ccc(F)cc1)C(C(=O)OC1CN2CCC1CC2)c1ccccc1 |
| InChI | InChI=1S/C23H26FN2O2/c1-25(15-17-7-9-20(24)10-8-17)22(19-5-3-2-4-6-19)23(27)28-21-16-26-13-11-18(21)12-14-26/h2-10,18,21-22H,1,11-16H2/q+1 |
| InChIKey | STFBMLXOROQFTF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|