C22H25FN2O2 — CID 59401102
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[(4-fluorophenyl)methylamino]-2-phenylacetate (PubChem CID 59401102) has the molecular formula C22H25FN2O2 and a molecular weight of 368.45 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[(4-fluorophenyl)methylamino]-2-phenylacetate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[(4-fluorophenyl)methylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 59401102 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[(4-fluorophenyl)methylamino]-2-phenylacetate |
| SMILES | O=C(O[C@H]1CN2CCC1CC2)C(NCc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H25FN2O2/c23-19-8-6-16(7-9-19)14-24-21(18-4-2-1-3-5-18)22(26)27-20-15-25-12-10-17(20)11-13-25/h1-9,17,20-21,24H,10-15H2/t20-,21?/m0/s1 |
| InChIKey | WKGODYPLBLQBMW-BGERDNNASA-N |
| XLogP | 3.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |