C23H26N2O5 — CID 134280156
3-[[[2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1-phenylethyl]amino]methyl]-2-hydroxybenzoic acid (PubChem CID 134280156) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3-[[[2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1-phenylethyl]amino]methyl]-2-hydroxybenzoic acid.
| Compound Name | 3-[[[2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1-phenylethyl]amino]methyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 134280156 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-[[[2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1-phenylethyl]amino]methyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cccc(CNC(C(=O)O[C@H]2CN3CCC2CC3)c2ccccc2)c1O |
| InChI | InChI=1S/C23H26N2O5/c26-21-17(7-4-8-18(21)22(27)28)13-24-20(16-5-2-1-3-6-16)23(29)30-19-14-25-11-9-15(19)10-12-25/h1-8,15,19-20,24,26H,9-14H2,(H,27,28)/t19-,20?/m0/s1 |
| InChIKey | QVEWQPVXHVAYEC-XJDOXCRVSA-N |
| XLogP | 2.56 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|