C23H36N2O2 — CID 160770790
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(cyclohexylamino)-2-phenylacetate;ethane (PubChem CID 160770790) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(cyclohexylamino)-2-phenylacetate;ethane.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(cyclohexylamino)-2-phenylacetate;ethane |
|---|---|
| PubChem CID | 160770790 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(cyclohexylamino)-2-phenylacetate;ethane |
| SMILES | CC.O=C(O[C@H]1CN2CCC1CC2)C(NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H30N2O2.C2H6/c24-21(25-19-15-23-13-11-16(19)12-14-23)20(17-7-3-1-4-8-17)22-18-9-5-2-6-10-18;1-2/h1,3-4,7-8,16,18-20,22H,2,5-6,9-15H2;1-2H3/t19-,20?;/m0./s1 |
| InChIKey | RZHBYHRTVKWOQC-CQLADDOKSA-N |
| XLogP | 4.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |