C16H22ClNO4 — CID 2929374
1-azabicyclo[2.2.2]octan-3-yl 2-(4-methoxyphenoxy)acetate;hydrochloride (PubChem CID 2929374) has the molecular formula C16H22ClNO4 and a molecular weight of 327.81 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl 2-(4-methoxyphenoxy)acetate;hydrochloride.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl 2-(4-methoxyphenoxy)acetate;hydrochloride |
|---|---|
| PubChem CID | 2929374 |
| Molecular Formula | C16H22ClNO4 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl 2-(4-methoxyphenoxy)acetate;hydrochloride |
| SMILES | COc1ccc(OCC(=O)OC2CN3CCC2CC3)cc1.Cl |
| InChI | InChI=1S/C16H21NO4.ClH/c1-19-13-2-4-14(5-3-13)20-11-16(18)21-15-10-17-8-6-12(15)7-9-17;/h2-5,12,15H,6-11H2,1H3;1H |
| InChIKey | HYIFEUPSHUXVKI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |