C26H33NO5 — CID 162062165
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 3-[3-(2,2-dimethoxyethoxy)phenyl]-3-phenylpropanoate (PubChem CID 162062165) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 3-[3-(2,2-dimethoxyethoxy)phenyl]-3-phenylpropanoate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 3-[3-(2,2-dimethoxyethoxy)phenyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 162062165 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 3-[3-(2,2-dimethoxyethoxy)phenyl]-3-phenylpropanoate |
| SMILES | COC(COc1cccc(C(CC(=O)O[C@H]2CN3CCC2CC3)c2ccccc2)c1)OC |
| InChI | InChI=1S/C26H33NO5/c1-29-26(30-2)18-31-22-10-6-9-21(15-22)23(19-7-4-3-5-8-19)16-25(28)32-24-17-27-13-11-20(24)12-14-27/h3-10,15,20,23-24,26H,11-14,16-18H2,1-2H3/t23?,24-/m0/s1 |
| InChIKey | YVRDUXTYEXWSSK-CGAIIQECSA-N |
| XLogP | 3.84 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|