C31H33NO5 — CID 152903215
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] (3S)-3-[3-[2-(4-formylphenoxy)ethoxy]phenyl]-3-phenylpropanoate (PubChem CID 152903215) has the molecular formula C31H33NO5 and a molecular weight of 499.61 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (3S)-3-[3-[2-(4-formylphenoxy)ethoxy]phenyl]-3-phenylpropanoate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (3S)-3-[3-[2-(4-formylphenoxy)ethoxy]phenyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 152903215 |
| Molecular Formula | C31H33NO5 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (3S)-3-[3-[2-(4-formylphenoxy)ethoxy]phenyl]-3-phenylpropanoate |
| SMILES | O=Cc1ccc(OCCOc2cccc([C@@H](CC(=O)O[C@H]3CN4CCC3CC4)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C31H33NO5/c33-22-23-9-11-27(12-10-23)35-17-18-36-28-8-4-7-26(19-28)29(24-5-2-1-3-6-24)20-31(34)37-30-21-32-15-13-25(30)14-16-32/h1-12,19,22,25,29-30H,13-18,20-21H2/t29-,30-/m0/s1 |
| InChIKey | UFSWHHCPHVKENT-KYJUHHDHSA-N |
| XLogP | 5.12 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|