C37H37NO4 — CID 158927532
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 3-[3-[2-[4-(4-formylphenyl)phenyl]ethoxy]phenyl]-3-phenylpropanoate (PubChem CID 158927532) has the molecular formula C37H37NO4 and a molecular weight of 559.71 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 3-[3-[2-[4-(4-formylphenyl)phenyl]ethoxy]phenyl]-3-phenylpropanoate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 3-[3-[2-[4-(4-formylphenyl)phenyl]ethoxy]phenyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 158927532 |
| Molecular Formula | C37H37NO4 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 3-[3-[2-[4-(4-formylphenyl)phenyl]ethoxy]phenyl]-3-phenylpropanoate |
| SMILES | O=Cc1ccc(-c2ccc(CCOc3cccc(C(CC(=O)O[C@H]4CN5CCC4CC5)c4ccccc4)c3)cc2)cc1 |
| InChI | InChI=1S/C37H37NO4/c39-26-28-11-15-30(16-12-28)29-13-9-27(10-14-29)19-22-41-34-8-4-7-33(23-34)35(31-5-2-1-3-6-31)24-37(40)42-36-25-38-20-17-32(36)18-21-38/h1-16,23,26,32,35-36H,17-22,24-25H2/t35?,36-/m0/s1 |
| InChIKey | JIPZUEBIJKKSMK-UHBYFKDRSA-N |
| XLogP | 6.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|