C30H31N3O5 — CID 90200625
[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[[3-[2-(4-formylanilino)-2-oxoethoxy]phenyl]-phenylmethyl]carbamic acid (PubChem CID 90200625) has the molecular formula C30H31N3O5 and a molecular weight of 513.59 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[[3-[2-(4-formylanilino)-2-oxoethoxy]phenyl]-phenylmethyl]carbamic acid.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[[3-[2-(4-formylanilino)-2-oxoethoxy]phenyl]-phenylmethyl]carbamic acid |
|---|---|
| PubChem CID | 90200625 |
| Molecular Formula | C30H31N3O5 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[[3-[2-(4-formylanilino)-2-oxoethoxy]phenyl]-phenylmethyl]carbamic acid |
| SMILES | O=Cc1ccc(NC(=O)COc2cccc(C(c3ccccc3)N(C(=O)O)[C@H]3CN4CCC3CC4)c2)cc1 |
| InChI | InChI=1S/C30H31N3O5/c34-19-21-9-11-25(12-10-21)31-28(35)20-38-26-8-4-7-24(17-26)29(23-5-2-1-3-6-23)33(30(36)37)27-18-32-15-13-22(27)14-16-32/h1-12,17,19,22,27,29H,13-16,18,20H2,(H,31,35)(H,36,37)/t27-,29?/m0/s1 |
| InChIKey | ATHMRKUFODDXPH-BVOOQYFDSA-N |
| XLogP | 4.68 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|