C34H44N4O7 — CID 90200731
[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[(S)-[3-[[4-(4,4-diethoxybutylcarbamoyl)-1,3-oxazol-2-yl]methoxy]phenyl]-phenylmethyl]carbamic acid (PubChem CID 90200731) has the molecular formula C34H44N4O7 and a molecular weight of 620.75 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[(S)-[3-[[4-(4,4-diethoxybutylcarbamoyl)-1,3-oxazol-2-yl]methoxy]phenyl]-phenylmethyl]carbamic acid.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[(S)-[3-[[4-(4,4-diethoxybutylcarbamoyl)-1,3-oxazol-2-yl]methoxy]phenyl]-phenylmethyl]carbamic acid |
|---|---|
| PubChem CID | 90200731 |
| Molecular Formula | C34H44N4O7 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[(S)-[3-[[4-(4,4-diethoxybutylcarbamoyl)-1,3-oxazol-2-yl]methoxy]phenyl]-phenylmethyl]carbamic acid |
| SMILES | CCOC(CCCNC(=O)c1coc(COc2cccc([C@H](c3ccccc3)N(C(=O)O)[C@H]3CN4CCC3CC4)c2)n1)OCC |
| InChI | InChI=1S/C34H44N4O7/c1-3-42-31(43-4-2)14-9-17-35-33(39)28-22-45-30(36-28)23-44-27-13-8-12-26(20-27)32(25-10-6-5-7-11-25)38(34(40)41)29-21-37-18-15-24(29)16-19-37/h5-8,10-13,20,22,24,29,31-32H,3-4,9,14-19,21,23H2,1-2H3,(H,35,39)(H,40,41)/t29-,32-/m0/s1 |
| InChIKey | IQKGBTAVBPXJEH-NYDCQLBNSA-N |
| XLogP | 5.33 |
| TPSA | 126.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|