C37H36N2O6 — CID 90200808
(3-formylphenyl)methyl 4-[[3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonylamino]-phenylmethyl]phenoxy]methyl]benzoate (PubChem CID 90200808) has the molecular formula C37H36N2O6 and a molecular weight of 604.70 g/mol. Its IUPAC name is (3-formylphenyl)methyl 4-[[3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonylamino]-phenylmethyl]phenoxy]methyl]benzoate.
| Compound Name | (3-formylphenyl)methyl 4-[[3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonylamino]-phenylmethyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 90200808 |
| Molecular Formula | C37H36N2O6 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | (3-formylphenyl)methyl 4-[[3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonylamino]-phenylmethyl]phenoxy]methyl]benzoate |
| SMILES | O=Cc1cccc(COC(=O)c2ccc(COc3cccc(C(NC(=O)O[C@H]4CN5CCC4CC5)c4ccccc4)c3)cc2)c1 |
| InChI | InChI=1S/C37H36N2O6/c40-23-27-6-4-7-28(20-27)25-44-36(41)31-14-12-26(13-15-31)24-43-33-11-5-10-32(21-33)35(30-8-2-1-3-9-30)38-37(42)45-34-22-39-18-16-29(34)17-19-39/h1-15,20-21,23,29,34-35H,16-19,22,24-25H2,(H,38,42)/t34-,35?/m0/s1 |
| InChIKey | WINZQHGLWKHKQY-SFCXHYMASA-N |
| XLogP | 6.34 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|