C29H31N3O4 — CID 118137129
[3-[(S)-(1-azabicyclo[2.2.2]octan-3-yloxycarbonylamino)-phenylmethyl]phenyl] 3-(aminomethyl)benzoate (PubChem CID 118137129) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is [3-[(S)-(1-azabicyclo[2.2.2]octan-3-yloxycarbonylamino)-phenylmethyl]phenyl] 3-(aminomethyl)benzoate.
| Compound Name | [3-[(S)-(1-azabicyclo[2.2.2]octan-3-yloxycarbonylamino)-phenylmethyl]phenyl] 3-(aminomethyl)benzoate |
|---|---|
| PubChem CID | 118137129 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | [3-[(S)-(1-azabicyclo[2.2.2]octan-3-yloxycarbonylamino)-phenylmethyl]phenyl] 3-(aminomethyl)benzoate |
| SMILES | NCc1cccc(C(=O)Oc2cccc([C@@H](NC(=O)OC3CN4CCC3CC4)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C29H31N3O4/c30-18-20-6-4-10-24(16-20)28(33)35-25-11-5-9-23(17-25)27(22-7-2-1-3-8-22)31-29(34)36-26-19-32-14-12-21(26)13-15-32/h1-11,16-17,21,26-27H,12-15,18-19,30H2,(H,31,34)/t26?,27-/m0/s1 |
| InChIKey | OFFOFZHNENQNHC-GEVKEYJPSA-N |
| XLogP | 4.27 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|