C27H28N2O6 — CID 144855391
[3-[(S)-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonylamino]-phenylmethyl]phenoxy]methyl furan-2-carboxylate (PubChem CID 144855391) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is [3-[(S)-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonylamino]-phenylmethyl]phenoxy]methyl furan-2-carboxylate.
| Compound Name | [3-[(S)-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonylamino]-phenylmethyl]phenoxy]methyl furan-2-carboxylate |
|---|---|
| PubChem CID | 144855391 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [3-[(S)-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonylamino]-phenylmethyl]phenoxy]methyl furan-2-carboxylate |
| SMILES | O=C(N[C@@H](c1ccccc1)c1cccc(OCOC(=O)c2ccco2)c1)O[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C27H28N2O6/c30-26(23-10-5-15-32-23)34-18-33-22-9-4-8-21(16-22)25(20-6-2-1-3-7-20)28-27(31)35-24-17-29-13-11-19(24)12-14-29/h1-10,15-16,19,24-25H,11-14,17-18H2,(H,28,31)/t24-,25-/m0/s1 |
| InChIKey | LMOUEOYQSXKYIN-DQEYMECFSA-N |
| XLogP | 4.38 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|