C17H21N3O5 — CID 11695936
1-azabicyclo[2.2.2]octan-3-yl 5-methoxy-1H-indazole-3-carboxylate;formic acid (PubChem CID 11695936) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl 5-methoxy-1H-indazole-3-carboxylate;formic acid.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl 5-methoxy-1H-indazole-3-carboxylate;formic acid |
|---|---|
| PubChem CID | 11695936 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl 5-methoxy-1H-indazole-3-carboxylate;formic acid |
| SMILES | COc1ccc2[nH]nc(C(=O)OC3CN4CCC3CC4)c2c1.O=CO |
| InChI | InChI=1S/C16H19N3O3.CH2O2/c1-21-11-2-3-13-12(8-11)15(18-17-13)16(20)22-14-9-19-6-4-10(14)5-7-19;2-1-3/h2-3,8,10,14H,4-7,9H2,1H3,(H,17,18);1H,(H,2,3) |
| InChIKey | YAKMMWFZOKUOMP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|