C15H19N5O — CID 39350754
(2R)-N-cyclohexyl-2-phenyl-2-(tetrazol-1-yl)acetamide (PubChem CID 39350754) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-phenyl-2-(tetrazol-1-yl)acetamide.
| Compound Name | (2R)-N-cyclohexyl-2-phenyl-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 39350754 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (2R)-N-cyclohexyl-2-phenyl-2-(tetrazol-1-yl)acetamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](c1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C15H19N5O/c21-15(17-13-9-5-2-6-10-13)14(20-11-16-18-19-20)12-7-3-1-4-8-12/h1,3-4,7-8,11,13-14H,2,5-6,9-10H2,(H,17,21)/t14-/m1/s1 |
| InChIKey | STCXHTFCQPNQTO-CQSZACIVSA-N |
| XLogP | 1.71 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |