C15H14N6O — CID 71829669
(2S)-2-phenyl-N-(pyridin-2-ylmethyl)-2-(tetrazol-1-yl)acetamide (PubChem CID 71829669) has the molecular formula C15H14N6O and a molecular weight of 294.32 g/mol. Its IUPAC name is (2S)-2-phenyl-N-(pyridin-2-ylmethyl)-2-(tetrazol-1-yl)acetamide.
| Compound Name | (2S)-2-phenyl-N-(pyridin-2-ylmethyl)-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 71829669 |
| Molecular Formula | C15H14N6O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (2S)-2-phenyl-N-(pyridin-2-ylmethyl)-2-(tetrazol-1-yl)acetamide |
| SMILES | O=C(NCc1ccccn1)[C@H](c1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C15H14N6O/c22-15(17-10-13-8-4-5-9-16-13)14(21-11-18-19-20-21)12-6-2-1-3-7-12/h1-9,11,14H,10H2,(H,17,22)/t14-/m0/s1 |
| InChIKey | ZVFCSBNKKBAUAJ-AWEZNQCLSA-N |
| XLogP | 0.97 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |