C16H22N6O3 — CID 97266583
tert-butyl N-[2-[[(2R)-2-phenyl-2-(tetrazol-1-yl)acetyl]amino]ethyl]carbamate (PubChem CID 97266583) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2R)-2-phenyl-2-(tetrazol-1-yl)acetyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2R)-2-phenyl-2-(tetrazol-1-yl)acetyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 97266583 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | tert-butyl N-[2-[[(2R)-2-phenyl-2-(tetrazol-1-yl)acetyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)[C@@H](c1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C16H22N6O3/c1-16(2,3)25-15(24)18-10-9-17-14(23)13(22-11-19-20-21-22)12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3,(H,17,23)(H,18,24)/t13-/m1/s1 |
| InChIKey | QSDLHJYBYQXIJM-CYBMUJFWSA-N |
| XLogP | 0.90 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|