C14H19N5O2S — CID 124850563
(2S)-N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]-2-phenyl-2-(tetrazol-1-yl)acetamide (PubChem CID 124850563) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is (2S)-N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]-2-phenyl-2-(tetrazol-1-yl)acetamide.
| Compound Name | (2S)-N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]-2-phenyl-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 124850563 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (2S)-N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]-2-phenyl-2-(tetrazol-1-yl)acetamide |
| SMILES | CSCC[C@H](CO)NC(=O)[C@H](c1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C14H19N5O2S/c1-22-8-7-12(9-20)16-14(21)13(19-10-15-17-18-19)11-5-3-2-4-6-11/h2-6,10,12-13,20H,7-9H2,1H3,(H,16,21)/t12-,13+/m1/s1 |
| InChIKey | QSZZLTWGIIRHBS-OLZOCXBDSA-N |
| XLogP | 0.49 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |