C14H20N6O2 — CID 103818149
tert-butyl N-[2-[4-(tetrazol-1-yl)anilino]ethyl]carbamate (PubChem CID 103818149) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(tetrazol-1-yl)anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(tetrazol-1-yl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 103818149 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | tert-butyl N-[2-[4-(tetrazol-1-yl)anilino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C14H20N6O2/c1-14(2,3)22-13(21)16-9-8-15-11-4-6-12(7-5-11)20-10-17-18-19-20/h4-7,10,15H,8-9H2,1-3H3,(H,16,21) |
| InChIKey | PJYYLXYOJZIWIX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|