C11H17N7O2 — CID 47453715
tert-butyl N-[2-(tetrazolo[1,5-b]pyridazin-6-ylamino)ethyl]carbamate (PubChem CID 47453715) has the molecular formula C11H17N7O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is tert-butyl N-[2-(tetrazolo[1,5-b]pyridazin-6-ylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(tetrazolo[1,5-b]pyridazin-6-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 47453715 |
| Molecular Formula | C11H17N7O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | tert-butyl N-[2-(tetrazolo[1,5-b]pyridazin-6-ylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc2nnnn2n1 |
| InChI | InChI=1S/C11H17N7O2/c1-11(2,3)20-10(19)13-7-6-12-8-4-5-9-14-16-17-18(9)15-8/h4-5H,6-7H2,1-3H3,(H,12,15)(H,13,19) |
| InChIKey | MKRTWGSIZARISN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|