C10H19N5O2 — CID 67159691
tert-butyl N-[2-(1-ethyltetrazol-5-yl)ethyl]carbamate (PubChem CID 67159691) has the molecular formula C10H19N5O2 and a molecular weight of 241.29 g/mol. Its IUPAC name is tert-butyl N-[2-(1-ethyltetrazol-5-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(1-ethyltetrazol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 67159691 |
| Molecular Formula | C10H19N5O2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | tert-butyl N-[2-(1-ethyltetrazol-5-yl)ethyl]carbamate |
| SMILES | CCn1nnnc1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19N5O2/c1-5-15-8(12-13-14-15)6-7-11-9(16)17-10(2,3)4/h5-7H2,1-4H3,(H,11,16) |
| InChIKey | IXQRWWAOWARCNC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |