C8H15N5O2 — CID 45092164
tert-butyl N-[(2-methyltetrazol-5-yl)methyl]carbamate (PubChem CID 45092164) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is tert-butyl N-[(2-methyltetrazol-5-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(2-methyltetrazol-5-yl)methyl]carbamate |
|---|---|
| PubChem CID | 45092164 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | tert-butyl N-[(2-methyltetrazol-5-yl)methyl]carbamate |
| SMILES | Cn1nnc(CNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C8H15N5O2/c1-8(2,3)15-7(14)9-5-6-10-12-13(4)11-6/h5H2,1-4H3,(H,9,14) |
| InChIKey | YALYSJRYXRSCJQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |