C9H17N5O2 — CID 90148596
tert-butyl N-[2-(5-methyltetrazol-2-yl)ethyl]carbamate (PubChem CID 90148596) has the molecular formula C9H17N5O2 and a molecular weight of 227.27 g/mol. Its IUPAC name is tert-butyl N-[2-(5-methyltetrazol-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(5-methyltetrazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 90148596 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | tert-butyl N-[2-(5-methyltetrazol-2-yl)ethyl]carbamate |
| SMILES | Cc1nnn(CCNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C9H17N5O2/c1-7-11-13-14(12-7)6-5-10-8(15)16-9(2,3)4/h5-6H2,1-4H3,(H,10,15) |
| InChIKey | CNRCSDMODRFUTM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |