C15H23N3O5 — CID 171616214
ethyl 5-acetyl-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]pyrazole-3-carboxylate (PubChem CID 171616214) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is ethyl 5-acetyl-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-acetyl-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 171616214 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | ethyl 5-acetyl-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(C)=O)n(CCNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C15H23N3O5/c1-6-22-13(20)11-9-12(10(2)19)18(17-11)8-7-16-14(21)23-15(3,4)5/h9H,6-8H2,1-5H3,(H,16,21) |
| InChIKey | CDPZFYODUYIGPS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |