C19H28N2O7 — CID 67145385
diethyl 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]pyridine-2,6-dicarboxylate (PubChem CID 67145385) has the molecular formula C19H28N2O7 and a molecular weight of 396.44 g/mol. Its IUPAC name is diethyl 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]pyridine-2,6-dicarboxylate.
| Compound Name | diethyl 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 67145385 |
| Molecular Formula | C19H28N2O7 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | diethyl 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]pyridine-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc(OCCCNC(=O)OC(C)(C)C)cc(C(=O)OCC)n1 |
| InChI | InChI=1S/C19H28N2O7/c1-6-25-16(22)14-11-13(12-15(21-14)17(23)26-7-2)27-10-8-9-20-18(24)28-19(3,4)5/h11-12H,6-10H2,1-5H3,(H,20,24) |
| InChIKey | FGDHWRMGKPKCJB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|