C15H23N3O5 — CID 135136562
methyl 5-amino-6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]pyridine-2-carboxylate (PubChem CID 135136562) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is methyl 5-amino-6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 135136562 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | methyl 5-amino-6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N)c(OCCCNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C15H23N3O5/c1-15(2,3)23-14(20)17-8-5-9-22-12-10(16)6-7-11(18-12)13(19)21-4/h6-7H,5,8-9,16H2,1-4H3,(H,17,20) |
| InChIKey | PTZOTHPRBSBYLR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|