C24H32N2O5 — CID 66815923
methyl 6-[3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]pyridine-2-carboxylate (PubChem CID 66815923) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is methyl 6-[3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 66815923 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | methyl 6-[3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(-c2cccc(OCCCCCCNC(=O)OC(C)(C)C)c2)n1 |
| InChI | InChI=1S/C24H32N2O5/c1-24(2,3)31-23(28)25-15-7-5-6-8-16-30-19-12-9-11-18(17-19)20-13-10-14-21(26-20)22(27)29-4/h9-14,17H,5-8,15-16H2,1-4H3,(H,25,28) |
| InChIKey | FZZJWOWKMDXKBU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|