C19H21N5O4 — CID 135142500
tert-butyl N-[2-[[6-(2,1,3-benzoxadiazol-5-yl)pyridine-2-carbonyl]amino]ethyl]carbamate (PubChem CID 135142500) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is tert-butyl N-[2-[[6-(2,1,3-benzoxadiazol-5-yl)pyridine-2-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[6-(2,1,3-benzoxadiazol-5-yl)pyridine-2-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 135142500 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | tert-butyl N-[2-[[6-(2,1,3-benzoxadiazol-5-yl)pyridine-2-carbonyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1cccc(-c2ccc3nonc3c2)n1 |
| InChI | InChI=1S/C19H21N5O4/c1-19(2,3)27-18(26)21-10-9-20-17(25)15-6-4-5-13(22-15)12-7-8-14-16(11-12)24-28-23-14/h4-8,11H,9-10H2,1-3H3,(H,20,25)(H,21,26) |
| InChIKey | YKXIYRILOROEEL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|