C16H21N3O4 — CID 135140889
tert-butyl N-[2-[(7-hydroxy-1H-indole-3-carbonyl)amino]ethyl]carbamate (PubChem CID 135140889) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is tert-butyl N-[2-[(7-hydroxy-1H-indole-3-carbonyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(7-hydroxy-1H-indole-3-carbonyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 135140889 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | tert-butyl N-[2-[(7-hydroxy-1H-indole-3-carbonyl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1c[nH]c2c(O)cccc12 |
| InChI | InChI=1S/C16H21N3O4/c1-16(2,3)23-15(22)18-8-7-17-14(21)11-9-19-13-10(11)5-4-6-12(13)20/h4-6,9,19-20H,7-8H2,1-3H3,(H,17,21)(H,18,22) |
| InChIKey | OYLJAYGZLJOYMU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|