C12H17ClN4O3 — CID 153127652
tert-butyl N-[2-[(6-chloropyrimidine-4-carbonyl)amino]ethyl]carbamate (PubChem CID 153127652) has the molecular formula C12H17ClN4O3 and a molecular weight of 300.75 g/mol. Its IUPAC name is tert-butyl N-[2-[(6-chloropyrimidine-4-carbonyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(6-chloropyrimidine-4-carbonyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 153127652 |
| Molecular Formula | C12H17ClN4O3 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | tert-butyl N-[2-[(6-chloropyrimidine-4-carbonyl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1cc(Cl)ncn1 |
| InChI | InChI=1S/C12H17ClN4O3/c1-12(2,3)20-11(19)15-5-4-14-10(18)8-6-9(13)17-7-16-8/h6-7H,4-5H2,1-3H3,(H,14,18)(H,15,19) |
| InChIKey | VWCGQNFJIHVNRQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|