C17H28ClN3O6 — CID 140799488
tert-butyl N-[2-[2-[2-[2-(6-chloropyrimidin-4-yl)oxyethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 140799488) has the molecular formula C17H28ClN3O6 and a molecular weight of 405.88 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-(6-chloropyrimidin-4-yl)oxyethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-(6-chloropyrimidin-4-yl)oxyethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 140799488 |
| Molecular Formula | C17H28ClN3O6 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-(6-chloropyrimidin-4-yl)oxyethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOc1cc(Cl)ncn1 |
| InChI | InChI=1S/C17H28ClN3O6/c1-17(2,3)27-16(22)19-4-5-23-6-7-24-8-9-25-10-11-26-15-12-14(18)20-13-21-15/h12-13H,4-11H2,1-3H3,(H,19,22) |
| InChIKey | AQGIDFKKPFEIBC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|