C19H38ClNO6 — CID 170540588
tert-butyl N-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 170540588) has the molecular formula C19H38ClNO6 and a molecular weight of 411.97 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 170540588 |
| Molecular Formula | C19H38ClNO6 |
| Molecular Weight | 411.97 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCCCCCCl |
| InChI | InChI=1S/C19H38ClNO6/c1-19(2,3)27-18(22)21-9-11-24-13-15-26-17-16-25-14-12-23-10-7-5-4-6-8-20/h4-17H2,1-3H3,(H,21,22) |
| InChIKey | KLIKKIYNMHZILE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.97 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|