C17H33ClN2O6 — CID 153344874
tert-butyl N-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-2-oxoethoxy]carbamate (PubChem CID 153344874) has the molecular formula C17H33ClN2O6 and a molecular weight of 396.91 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-2-oxoethoxy]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-2-oxoethoxy]carbamate |
|---|---|
| PubChem CID | 153344874 |
| Molecular Formula | C17H33ClN2O6 |
| Molecular Weight | 396.91 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-2-oxoethoxy]carbamate |
| SMILES | CC(C)(C)OC(=O)NOCC(=O)NCCOCCOCCCCCCCl |
| InChI | InChI=1S/C17H33ClN2O6/c1-17(2,3)26-16(22)20-25-14-15(21)19-9-11-24-13-12-23-10-7-5-4-6-8-18/h4-14H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | XWMVGVDRWNUDCL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.91 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|