C9H19N3O4 — CID 87181188
tert-butyl N-[2-(2-aminoethylamino)-2-oxoethoxy]carbamate (PubChem CID 87181188) has the molecular formula C9H19N3O4 and a molecular weight of 233.27 g/mol. Its IUPAC name is tert-butyl N-[2-(2-aminoethylamino)-2-oxoethoxy]carbamate.
| Compound Name | tert-butyl N-[2-(2-aminoethylamino)-2-oxoethoxy]carbamate |
|---|---|
| PubChem CID | 87181188 |
| Molecular Formula | C9H19N3O4 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | tert-butyl N-[2-(2-aminoethylamino)-2-oxoethoxy]carbamate |
| SMILES | CC(C)(C)OC(=O)NOCC(=O)NCCN |
| InChI | InChI=1S/C9H19N3O4/c1-9(2,3)16-8(14)12-15-6-7(13)11-5-4-10/h4-6,10H2,1-3H3,(H,11,13)(H,12,14) |
| InChIKey | AKZPPBPGCWBGMX-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|