C23H40N4O5 — CID 87121346
tert-butyl N-(2-aminoethyl)carbamate;tert-butyl N-[2-(3-prop-2-ynylhex-5-ynoylamino)ethyl]carbamate (PubChem CID 87121346) has the molecular formula C23H40N4O5 and a molecular weight of 452.60 g/mol. Its IUPAC name is tert-butyl N-(2-aminoethyl)carbamate;tert-butyl N-[2-(3-prop-2-ynylhex-5-ynoylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-(2-aminoethyl)carbamate;tert-butyl N-[2-(3-prop-2-ynylhex-5-ynoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 87121346 |
| Molecular Formula | C23H40N4O5 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | tert-butyl N-(2-aminoethyl)carbamate;tert-butyl N-[2-(3-prop-2-ynylhex-5-ynoylamino)ethyl]carbamate |
| SMILES | C#CCC(CC#C)CC(=O)NCCNC(=O)OC(C)(C)C.CC(C)(C)OC(=O)NCCN |
| InChI | InChI=1S/C16H24N2O3.C7H16N2O2/c1-6-8-13(9-7-2)12-14(19)17-10-11-18-15(20)21-16(3,4)5;1-7(2,3)11-6(10)9-5-4-8/h1-2,13H,8-12H2,3-5H3,(H,17,19)(H,18,20);4-5,8H2,1-3H3,(H,9,10) |
| InChIKey | UIXHZJVLKWEWMG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|