C13H28N2O4 — CID 174908055
tert-butyl N-(8-amino-3,6-dihydroxyoctyl)carbamate (PubChem CID 174908055) has the molecular formula C13H28N2O4 and a molecular weight of 276.38 g/mol. Its IUPAC name is tert-butyl N-(8-amino-3,6-dihydroxyoctyl)carbamate.
| Compound Name | tert-butyl N-(8-amino-3,6-dihydroxyoctyl)carbamate |
|---|---|
| PubChem CID | 174908055 |
| Molecular Formula | C13H28N2O4 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | tert-butyl N-(8-amino-3,6-dihydroxyoctyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)CCC(O)CCN |
| InChI | InChI=1S/C13H28N2O4/c1-13(2,3)19-12(18)15-9-7-11(17)5-4-10(16)6-8-14/h10-11,16-17H,4-9,14H2,1-3H3,(H,15,18) |
| InChIKey | WTNUUSJQWVISJD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |