C20H43N3O7 — CID 160721898
tert-butyl N-(2-aminoethyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;propan-1-amine (PubChem CID 160721898) has the molecular formula C20H43N3O7 and a molecular weight of 437.58 g/mol. Its IUPAC name is tert-butyl N-(2-aminoethyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;propan-1-amine.
| Compound Name | tert-butyl N-(2-aminoethyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;propan-1-amine |
|---|---|
| PubChem CID | 160721898 |
| Molecular Formula | C20H43N3O7 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.31 |
| IUPAC Name | tert-butyl N-(2-aminoethyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;propan-1-amine |
| SMILES | CC(C)(C)OC(=O)NCCN.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CCCN |
| InChI | InChI=1S/C10H18O5.C7H16N2O2.C3H9N/c1-9(2,3)14-7(11)13-8(12)15-10(4,5)6;1-7(2,3)11-6(10)9-5-4-8;1-2-3-4/h1-6H3;4-5,8H2,1-3H3,(H,9,10);2-4H2,1H3 |
| InChIKey | RTFCCTXCSDONQJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 152.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|