C9H21N3O2 — CID 170622454
tert-butyl N-(2,3-diamino-2-methylpropyl)carbamate (PubChem CID 170622454) has the molecular formula C9H21N3O2 and a molecular weight of 203.29 g/mol. Its IUPAC name is tert-butyl N-(2,3-diamino-2-methylpropyl)carbamate.
| Compound Name | tert-butyl N-(2,3-diamino-2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 170622454 |
| Molecular Formula | C9H21N3O2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.16 |
| IUPAC Name | tert-butyl N-(2,3-diamino-2-methylpropyl)carbamate |
| SMILES | CC(N)(CN)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H21N3O2/c1-8(2,3)14-7(13)12-6-9(4,11)5-10/h5-6,10-11H2,1-4H3,(H,12,13) |
| InChIKey | ZWWWSTATAIECEU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |