C9H20N2O4 — CID 154779852
tert-butyl N-[2-amino-3-hydroxy-2-(hydroxymethyl)propyl]carbamate (PubChem CID 154779852) has the molecular formula C9H20N2O4 and a molecular weight of 220.27 g/mol. Its IUPAC name is tert-butyl N-[2-amino-3-hydroxy-2-(hydroxymethyl)propyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-3-hydroxy-2-(hydroxymethyl)propyl]carbamate |
|---|---|
| PubChem CID | 154779852 |
| Molecular Formula | C9H20N2O4 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | tert-butyl N-[2-amino-3-hydroxy-2-(hydroxymethyl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(N)(CO)CO |
| InChI | InChI=1S/C9H20N2O4/c1-8(2,3)15-7(14)11-4-9(10,5-12)6-13/h12-13H,4-6,10H2,1-3H3,(H,11,14) |
| InChIKey | QFBHCUJBSRREDZ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |