C20H38N4O10 — CID 59658355
tert-butyl N-[2-[2-[2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetyl]amino]ethoxy]ethoxy]ethylamino]-2-oxoethoxy]carbamate (PubChem CID 59658355) has the molecular formula C20H38N4O10 and a molecular weight of 494.54 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetyl]amino]ethoxy]ethoxy]ethylamino]-2-oxoethoxy]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetyl]amino]ethoxy]ethoxy]ethylamino]-2-oxoethoxy]carbamate |
|---|---|
| PubChem CID | 59658355 |
| Molecular Formula | C20H38N4O10 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetyl]amino]ethoxy]ethoxy]ethylamino]-2-oxoethoxy]carbamate |
| SMILES | CC(C)(C)OC(=O)NOCC(=O)NCCOCCOCCNC(=O)CONC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H38N4O10/c1-19(2,3)33-17(27)23-31-13-15(25)21-7-9-29-11-12-30-10-8-22-16(26)14-32-24-18(28)34-20(4,5)6/h7-14H2,1-6H3,(H,21,25)(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | RFUVHCWANDPTOG-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 171.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|