C20H37N3O11 — CID 146808524
methyl 2-[2-[2-[[2-[2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetyl]amino]ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetate (PubChem CID 146808524) has the molecular formula C20H37N3O11 and a molecular weight of 495.53 g/mol. Its IUPAC name is methyl 2-[2-[2-[[2-[2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetyl]amino]ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetate.
| Compound Name | methyl 2-[2-[2-[[2-[2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetyl]amino]ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 146808524 |
| Molecular Formula | C20H37N3O11 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | methyl 2-[2-[2-[[2-[2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetyl]amino]ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetate |
| SMILES | COC(=O)COCCOCCNC(=O)COCCOCCNC(=O)CONC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37N3O11/c1-20(2,3)34-19(27)23-33-14-17(25)22-6-8-29-9-11-31-13-16(24)21-5-7-30-10-12-32-15-18(26)28-4/h5-15H2,1-4H3,(H,21,24)(H,22,25)(H,23,27) |
| InChIKey | RZOZEXAPXHCJAJ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 168.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|