C15H30N4O8 — CID 121257831
tert-butyl N-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethoxy]ethoxy]ethylamino]-2-oxoethoxy]carbamate (PubChem CID 121257831) has the molecular formula C15H30N4O8 and a molecular weight of 394.43 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethoxy]ethoxy]ethylamino]-2-oxoethoxy]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethoxy]ethoxy]ethylamino]-2-oxoethoxy]carbamate |
|---|---|
| PubChem CID | 121257831 |
| Molecular Formula | C15H30N4O8 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethoxy]ethoxy]ethylamino]-2-oxoethoxy]carbamate |
| SMILES | CC(C)(C)OC(=O)NOCC(=O)NCCOCCOCCNC(=O)CON |
| InChI | InChI=1S/C15H30N4O8/c1-15(2,3)27-14(22)19-26-11-13(21)18-5-7-24-9-8-23-6-4-17-12(20)10-25-16/h4-11,16H2,1-3H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | XSOCFXRIUHIKOL-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 159.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|