C21H40N2O9 — CID 134514732
8-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethoxy]ethylamino]-8-oxooctanoic acid (PubChem CID 134514732) has the molecular formula C21H40N2O9 and a molecular weight of 464.56 g/mol. Its IUPAC name is 8-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethoxy]ethylamino]-8-oxooctanoic acid.
| Compound Name | 8-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethoxy]ethylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 134514732 |
| Molecular Formula | C21H40N2O9 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 8-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethoxy]ethylamino]-8-oxooctanoic acid |
| SMILES | CC(C)(C)OC(=O)NOCCOCCOCCOCCNC(=O)CCCCCCC(=O)O |
| InChI | InChI=1S/C21H40N2O9/c1-21(2,3)32-20(27)23-31-17-16-30-15-14-29-13-12-28-11-10-22-18(24)8-6-4-5-7-9-19(25)26/h4-17H2,1-3H3,(H,22,24)(H,23,27)(H,25,26) |
| InChIKey | PYLXHUMYNJGKQO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|