C18H35ClN2O5 — CID 170368371
tert-butyl N-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-2-oxoethyl]-N-methylcarbamate (PubChem CID 170368371) has the molecular formula C18H35ClN2O5 and a molecular weight of 394.94 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-2-oxoethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 170368371 |
| Molecular Formula | C18H35ClN2O5 |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-2-oxoethyl]-N-methylcarbamate |
| SMILES | CN(CC(=O)NCCOCCOCCCCCCCl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H35ClN2O5/c1-18(2,3)26-17(23)21(4)15-16(22)20-10-12-25-14-13-24-11-8-6-5-7-9-19/h5-15H2,1-4H3,(H,20,22) |
| InChIKey | WBUITAFIUVCYCV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|