C14H29ClN2O3 — CID 170368379
N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-(dimethylamino)acetamide (PubChem CID 170368379) has the molecular formula C14H29ClN2O3 and a molecular weight of 308.85 g/mol. Its IUPAC name is N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 170368379 |
| Molecular Formula | C14H29ClN2O3 |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-(dimethylamino)acetamide |
| SMILES | CN(C)CC(=O)NCCOCCOCCCCCCCl |
| InChI | InChI=1S/C14H29ClN2O3/c1-17(2)13-14(18)16-8-10-20-12-11-19-9-6-4-3-5-7-15/h3-13H2,1-2H3,(H,16,18) |
| InChIKey | WLOYBCPRQAZAET-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|