C24H35ClN2O3 — CID 102440670
N-[2-[2-(7-chloroheptoxy)ethoxy]ethyl]-6-(dimethylamino)naphthalene-2-carboxamide (PubChem CID 102440670) has the molecular formula C24H35ClN2O3 and a molecular weight of 435.01 g/mol. Its IUPAC name is N-[2-[2-(7-chloroheptoxy)ethoxy]ethyl]-6-(dimethylamino)naphthalene-2-carboxamide.
| Compound Name | N-[2-[2-(7-chloroheptoxy)ethoxy]ethyl]-6-(dimethylamino)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 102440670 |
| Molecular Formula | C24H35ClN2O3 |
| Molecular Weight | 435.01 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[2-[2-(7-chloroheptoxy)ethoxy]ethyl]-6-(dimethylamino)naphthalene-2-carboxamide |
| SMILES | CN(C)c1ccc2cc(C(=O)NCCOCCOCCCCCCCCl)ccc2c1 |
| InChI | InChI=1S/C24H35ClN2O3/c1-27(2)23-11-10-20-18-22(9-8-21(20)19-23)24(28)26-13-15-30-17-16-29-14-7-5-3-4-6-12-25/h8-11,18-19H,3-7,12-17H2,1-2H3,(H,26,28) |
| InChIKey | IQOYLETWUFHYDZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.01 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|