C36H44ClN3O6 — CID 135278090
2-[3',6'-bis(dimethylamino)-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl]-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide (PubChem CID 135278090) has the molecular formula C36H44ClN3O6 and a molecular weight of 650.22 g/mol. Its IUPAC name is 2-[3',6'-bis(dimethylamino)-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl]-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide.
| Compound Name | 2-[3',6'-bis(dimethylamino)-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl]-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 135278090 |
| Molecular Formula | C36H44ClN3O6 |
| Molecular Weight | 650.22 g/mol |
| Exact Mass | 649.29 |
| IUPAC Name | 2-[3',6'-bis(dimethylamino)-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl]-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide |
| SMILES | CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C21OC(=O)c2ccc(CC(=O)NCCOCCOCCCCCCCl)cc21 |
| InChI | InChI=1S/C36H44ClN3O6/c1-39(2)26-10-13-29-32(23-26)45-33-24-27(40(3)4)11-14-30(33)36(29)31-21-25(9-12-28(31)35(42)46-36)22-34(41)38-16-18-44-20-19-43-17-8-6-5-7-15-37/h9-14,21,23-24H,5-8,15-20,22H2,1-4H3,(H,38,41) |
| InChIKey | DKUQEPQSRSDOIU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.22 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|