C47H59ClN2O11 — CID 10328246
[6-[[6-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-6-oxohexyl]carbamoyl]-6'-(2,2-dimethylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate (PubChem CID 10328246) has the molecular formula C47H59ClN2O11 and a molecular weight of 863.44 g/mol. Its IUPAC name is [6-[[6-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-6-oxohexyl]carbamoyl]-6'-(2,2-dimethylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate.
| Compound Name | [6-[[6-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-6-oxohexyl]carbamoyl]-6'-(2,2-dimethylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10328246 |
| Molecular Formula | C47H59ClN2O11 |
| Molecular Weight | 863.44 g/mol |
| Exact Mass | 862.38 |
| IUPAC Name | [6-[[6-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-6-oxohexyl]carbamoyl]-6'-(2,2-dimethylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2c(c1)Oc1cc(OC(=O)C(C)(C)C)ccc1C21OC(=O)c2ccc(C(=O)NCCCCCC(=O)NCCOCCOCCCCCCCl)cc21 |
| InChI | InChI=1S/C47H59ClN2O11/c1-45(2,3)43(54)58-32-16-19-35-38(29-32)60-39-30-33(59-44(55)46(4,5)6)17-20-36(39)47(35)37-28-31(15-18-34(37)42(53)61-47)41(52)50-22-12-9-10-14-40(51)49-23-25-57-27-26-56-24-13-8-7-11-21-48/h15-20,28-30H,7-14,21-27H2,1-6H3,(H,49,51)(H,50,52) |
| InChIKey | CAMRACJJVYSBKL-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 164.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.44 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|